CAS 75776-48-6
:4,6-Diamino-3-pyridinecarboxylic acid
Description:
4,6-Diamino-3-pyridinecarboxylic acid, also known as DAPCA, is an organic compound characterized by its pyridine ring structure, which features two amino groups at the 4 and 6 positions and a carboxylic acid group at the 3 position. This compound is a derivative of pyridine and is notable for its potential applications in pharmaceuticals and biochemistry, particularly in the synthesis of various bioactive molecules. The presence of multiple amino groups enhances its reactivity and solubility in polar solvents, making it useful in various chemical reactions, including peptide synthesis and as a building block in drug development. Additionally, the carboxylic acid group contributes to its acidic properties, allowing it to participate in acid-base reactions. Its molecular structure allows for hydrogen bonding, which can influence its interactions with other molecules. Overall, 4,6-Diamino-3-pyridinecarboxylic acid is a versatile compound with significant implications in medicinal chemistry and related fields.
Formula:C6H7N3O2
InChI:InChI=1S/C6H7N3O2/c7-4-1-5(8)9-2-3(4)6(10)11/h1-2H,(H,10,11)(H4,7,8,9)
InChI key:InChIKey=FUEWJOFERVOKPI-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(N)=CC(N)=NC1
Synonyms:- 3-Pyridinecarboxylicacid,4,6-diamino-(9CI)
- 3-Pyridinecarboxylic acid, 4,6-diamino-
- 4,6-Diamino-3-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
