CAS 7578-68-9
:3-Acetoxyflavone
Description:
3-Acetoxyflavone, with the CAS number 7578-68-9, is a synthetic flavonoid compound characterized by its acetoxy group at the 3-position of the flavone backbone. This compound typically exhibits a yellow to orange color, which is common among flavonoids due to their conjugated double bond systems that allow for light absorption in the visible spectrum. 3-Acetoxyflavone is known for its potential biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties, making it of interest in pharmacological research. The presence of the acetoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with biological targets. In terms of stability, flavonoids can be sensitive to light and heat, which may affect their efficacy and shelf life. Overall, 3-acetoxyflavone represents a valuable compound in the study of natural products and their applications in health and medicine.
Formula:C17H12O4
InChI:InChI=1/C17H12O4/c1-11(18)20-17-15(19)13-9-5-6-10-14(13)21-16(17)12-7-3-2-4-8-12/h2-10H,1H3
SMILES:CC(=O)Oc1c(=O)c2ccccc2oc1c1ccccc1
Synonyms:- 4-oxo-2-phenyl-4H-chromen-3-yl acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.