CymitQuimica logo

CAS 75780-06-2

:

(difluoromethoxy)(difluoro)acetic acid

Description:
Difluoromethoxy(difluoro)acetic acid, identified by its CAS number 75780-06-2, is a fluorinated organic compound characterized by the presence of both difluoromethoxy and acetic acid functional groups. This compound typically exhibits a polar nature due to the electronegative fluorine atoms and the carboxylic acid group, which can influence its solubility in polar solvents. The presence of fluorine atoms often imparts unique properties, such as increased stability and altered reactivity compared to non-fluorinated analogs. Difluoromethoxy(difluoro)acetic acid may be utilized in various applications, including as an intermediate in organic synthesis or in the development of pharmaceuticals, where fluorinated compounds are known to enhance biological activity. Its chemical behavior can be influenced by factors such as pH and temperature, and it may participate in reactions typical of carboxylic acids, including esterification and acid-base reactions. Safety data should be consulted for handling and storage, as fluorinated compounds can exhibit toxicity and environmental persistence.
Formula:C3H2F4O3
InChI:InChI=1/C3H2F4O3/c4-2(5)10-3(6,7)1(8)9/h2H,(H,8,9)
SMILES:C(=O)(C(F)(F)OC(F)F)O
Synonyms:
  • Acetic acid, (difluoromethoxy)difluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.