CAS 75782-22-8

1-(pyrimidin-2-yl)propan-2-one

Description:

1-(Pyrimidin-2-yl)propan-2-one, with the CAS number 75782-22-8, is an organic compound characterized by its pyrimidine ring structure attached to a propan-2-one moiety. This compound features a pyrimidine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms at the 1 and 3 positions. The propan-2-one part indicates the presence of a ketone functional group, contributing to its reactivity and potential applications in organic synthesis. Typically, compounds like this exhibit moderate polarity due to the presence of both aromatic and carbonyl functionalities, which can influence their solubility in various solvents. Additionally, the presence of the pyrimidine ring may impart biological activity, making such compounds of interest in medicinal chemistry and drug development. The compound's physical properties, such as melting point, boiling point, and spectral characteristics, would be determined through experimental methods and can vary based on purity and environmental conditions. Overall, 1-(pyrimidin-2-yl)propan-2-one represents a versatile structure in organic chemistry with potential applications in various fields.

Formula: C₇H₈N₂O

InChI: InChI=1/C7H8N2O/c1-6(10)5-7-8-3-2-4-9-7/h2-4H,5H2,1H3

SMILES: CC(=O)Cc1ncccn1

Synonyms:

• 1-(Pyrimidin-2-yl)acetone
• 2-Propanone, 1-(2-pyrimidinyl)-

1-(2-Pyrimidinyl)-2-propanone

CAS: 75782-22-8

Formula: C₇H₈N₂O

Molecular weight: 136.1512

Ref: IN-DA005UIP

1-(Pyrimidin-2-yl)propan-2-one

CAS: 75782-22-8

1-(Pyrimidin-2-yl)propan-2-one is an intermediate used in the production of diketene, a fungicide. It is a colorless liquid with a pungent odor and is soluble in organic solvents. This compound has been shown to have antifungal activity against many species of fungi and can be used as an intermediate for other agrochemicals.

Formula: C₇H₈N₂O

Purity: Min. 95%

Molecular weight: 136.15 g/mol

Ref: 3D-ADA78222