CAS 757878-04-9

(1Z)-2-(3,4-dimethoxyphenyl)ethanimidamide

Description:

(1Z)-2-(3,4-dimethoxyphenyl)ethanimidamide is a chemical compound characterized by its unique structural features, including an ethanimidamide functional group and a substituted phenyl ring. The presence of two methoxy groups on the phenyl ring enhances its electron-donating properties, which can influence the compound's reactivity and solubility. This compound is likely to exhibit specific biological activities due to its structural characteristics, making it of interest in medicinal chemistry and pharmacology. The (1Z) designation indicates a specific geometric isomerism, which can affect the compound's interaction with biological targets. Its CAS number, 757878-04-9, allows for precise identification and retrieval of information regarding its properties, synthesis, and applications in scientific literature. Overall, the compound's unique structure and potential biological relevance make it a subject of interest for further research and development in various chemical and pharmaceutical applications.

Formula: C₁₀H₁₄N₂O₂

InChI: InChI=1/C10H14N2O2/c1-13-8-4-3-7(6-10(11)12)5-9(8)14-2/h3-5H,6H2,1-2H3,(H3,11,12)

SMILES: COc1ccc(cc1OC)CC(=N)N