CymitQuimica logo

CAS 75788-67-9

:

10H-Phenothiazine, homopolymer

Description:
10H-Phenothiazine, homopolymer, identified by CAS number 75788-67-9, is a polymer derived from the phenothiazine monomer, which is a heterocyclic compound featuring a sulfur atom and a nitrogen atom in its structure. This polymer exhibits unique properties due to its conjugated system, which can contribute to its electronic and optical characteristics. Typically, it is characterized by its stability, solubility in organic solvents, and potential for forming films or coatings. The polymer may also display interesting photophysical properties, making it useful in applications such as organic electronics, sensors, and as a dye. Additionally, due to the presence of sulfur and nitrogen, it may exhibit biological activity, which could be relevant in pharmaceutical applications. Its thermal and mechanical properties can vary based on the degree of polymerization and processing conditions. Overall, 10H-Phenothiazine, homopolymer, represents a versatile material with potential applications across various fields, including materials science and medicinal chemistry.
Formula:(C12H9NS)x
InChI:InChI=1S/C12H9NS/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-8,13H
InChI key:InChIKey=WJFKNYWRSNBZNX-UHFFFAOYSA-N
SMILES:C1=2C(SC=3C(N1)=CC=CC3)=CC=CC2
Synonyms:
  • Polyphenothiazine
  • 10H-Phenothiazine, homopolymer
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.