CymitQuimica logo

CAS 7579-70-6

:

(3-methylphenyl)-diphenyl-phosphane

Description:
(3-Methylphenyl)-diphenyl-phosphane, also known as triphenylphosphine derivative, is an organophosphorus compound characterized by the presence of a phosphorus atom bonded to three phenyl groups and one 3-methylphenyl group. This compound typically exhibits a white to light yellow crystalline appearance and is soluble in organic solvents such as benzene and dichloromethane, but insoluble in water. It is known for its role as a ligand in coordination chemistry and catalysis, particularly in reactions involving transition metals. The presence of the methyl group on the phenyl ring can influence the electronic properties and steric hindrance of the molecule, affecting its reactivity and interactions with other chemical species. Additionally, (3-methylphenyl)-diphenyl-phosphane can participate in various chemical reactions, including oxidation and nucleophilic substitution, making it a valuable compound in organic synthesis and materials science. Safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C19H17P
InChI:InChI=1/C19H17P/c1-16-9-8-14-19(15-16)20(17-10-4-2-5-11-17)18-12-6-3-7-13-18/h2-15H,1H3
InChI key:BGUPWTFDMHDYIR-UHFFFAOYSA-N
SMILES:CC1=CC(=CC=C1)P(C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:
  • (3-methylphenyl)-diphenyl-phosphane
  • Diphenyl-m-tolylphosphine
  • See more synonyms
Found 2 products.