CAS 75792-87-9
:3-hydrazino-6-thiophen-2-ylpyridazine
Description:
3-Hydrazino-6-thiophen-2-ylpyridazine is a chemical compound characterized by its unique structural features, which include a pyridazine ring substituted with a hydrazino group and a thiophene moiety. The presence of the hydrazino functional group imparts potential reactivity, particularly in forming hydrazones or participating in condensation reactions. The thiophene ring contributes to the compound's aromaticity and may influence its electronic properties, making it of interest in various applications, including pharmaceuticals and agrochemicals. This compound may exhibit biological activity due to its structural components, which can interact with biological targets. Additionally, its solubility and stability in different solvents can vary, affecting its practical applications. The compound's CAS number, 75792-87-9, allows for easy identification and retrieval of information in chemical databases. Overall, 3-hydrazino-6-thiophen-2-ylpyridazine represents a class of compounds that may be explored for their potential utility in medicinal chemistry and material science.
Formula:C8H8N4S
InChI:InChI=1/C8H8N4S/c9-10-8-4-3-6(11-12-8)7-2-1-5-13-7/h1-5H,9H2,(H,10,12)
SMILES:c1cc(c2ccc(=NN)[nH]n2)sc1
Synonyms:- 3-Hydrazino-6-(2-thienyl)pyridazine
- Pyridazine, 3-Hydrazinyl-6-(2-Thienyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.