CymitQuimica logo

CAS 75795-07-2

:

bis(3,4-dichlorophenyl)methanone

Description:
Bis(3,4-dichlorophenyl)methanone, with the CAS number 75795-07-2, is an organic compound characterized by its structure, which features two 3,4-dichlorophenyl groups attached to a central carbonyl (C=O) functional group. This compound is typically a solid at room temperature and exhibits a crystalline appearance. It is known for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its reactivity and ability to participate in further chemical transformations. The presence of the dichlorophenyl groups contributes to its hydrophobic nature and may influence its biological activity. Additionally, the compound may exhibit properties such as moderate solubility in organic solvents and limited solubility in water. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, bis(3,4-dichlorophenyl)methanone is a notable compound in organic chemistry, with specific characteristics that make it of interest for further research and application.
Formula:C13H6Cl4O
InChI:InChI=1/C13H6Cl4O/c14-9-3-1-7(5-11(9)16)13(18)8-2-4-10(15)12(17)6-8/h1-6H
SMILES:c1cc(c(cc1C(=O)c1ccc(c(c1)Cl)Cl)Cl)Cl
Synonyms:
  • Methanone, bis(3,4-dichlorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.