
CAS 758-10-1
:Thioglycine
Description:
Thioglycine, with the CAS number 758-10-1, is an amino acid characterized by the presence of a thiol group (-SH) in its structure, which distinguishes it from standard amino acids. It has the chemical formula C2H5NOS and is classified as a non-proteinogenic amino acid. Thioglycine is a colorless to pale yellow solid that is soluble in water and exhibits a slightly sweet taste. Its structure includes an amino group (-NH2), a carboxylic acid group (-COOH), and a thiol group, which contributes to its unique reactivity and properties. Thioglycine is known for its reducing properties, making it useful in various chemical reactions, including peptide synthesis and as a reagent in analytical chemistry. Additionally, it can act as a stabilizing agent in certain formulations. Due to its thiol group, thioglycine can participate in redox reactions and form disulfide bonds, which are important in biochemical processes. Overall, thioglycine is a versatile compound with applications in biochemistry and organic synthesis.
Formula:C2H5NOS
InChI:InChI=1S/C2H5NOS/c3-1-2(4)5/h1,3H2,(H,4,5)
InChI key:InChIKey=CYFJIBWZIQDUSZ-UHFFFAOYSA-N
SMILES:C(CN)(=O)S
Synonyms:- Glycine, thio-
- Ethanethioic acid, amino-
- Aminothioacetic acid
- Thioglycine
- 2-Aminoethanethioic O-acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Thioglycine
CAS:Thioglycine is a naturally occurring amino acid that binds to G-protein coupled receptors. It has been shown to be useful in the treatment of metabolic disorders and chronic bronchitis. Thioglycine has an antimicrobial effect, inhibiting the growth of bacteria by binding to iron and copper ions, which are required for bacterial metabolism. Thioglycine also binds to proteins in the cell wall, causing the cell wall to rupture, leading to cell death. This compound has been shown to have a number of other pharmacological effects including: anti-inflammatory activities, modulation of energy metabolism, and inhibition of chronic bronchitis.Formula:C2H5NOSPurity:Min. 95%Molecular weight:91.13 g/mol

