CymitQuimica logo

CAS 758-18-9

:

Ethanamine, N,N-difluoro-

Description:
Ethanamine, N,N-difluoro- is an organic compound characterized by the presence of an amine functional group and two fluorine atoms attached to the nitrogen. Its molecular structure consists of a two-carbon ethyl chain with the amine group (-NH2) at one end and two fluorine atoms bonded to the nitrogen atom. This compound is typically a colorless to pale yellow liquid with a distinct amine odor. It is soluble in water and polar organic solvents due to its ability to form hydrogen bonds. The presence of fluorine atoms enhances its reactivity and can influence its physical properties, such as boiling point and polarity. N,N-difluoroethanamine is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential applications in synthesis and as a building block for more complex molecules. However, handling this compound requires caution due to its potential toxicity and reactivity. Always refer to safety data sheets and regulatory guidelines when working with chemical substances.
Formula:C2H5F2N
InChI:InChI=1S/C2H5F2N/c1-2-5(3)4/h2H2,1H3
InChI key:InChIKey=IAUJKTVVMRFADH-UHFFFAOYSA-N
SMILES:N(CC)(F)F
Synonyms:
  • Ethylamine, N,N-difluoro-
  • N,N-Difluoroethylamine
  • ethanamine, N,N-difluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.