
CAS 7580-88-3
:Ethyl 2-(fluoromethyl)-2-propenoate
Description:
Ethyl 2-(fluoromethyl)-2-propenoate, with the CAS number 7580-88-3, is an organic compound characterized by its ester functional group and a fluoromethyl substituent on the propenoate backbone. This compound typically appears as a colorless to pale yellow liquid and has a distinctive fruity odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic nature. Ethyl 2-(fluoromethyl)-2-propenoate is known for its reactivity, particularly in polymerization reactions, making it useful in the synthesis of various polymers and copolymers. The presence of the fluoromethyl group can enhance the compound's chemical stability and influence its reactivity in organic synthesis. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested. Overall, its unique structure and properties make it a valuable intermediate in organic chemistry and materials science.
Formula:C6H9FO2
InChI:InChI=1S/C6H9FO2/c1-3-9-6(8)5(2)4-7/h2-4H2,1H3
InChI key:InChIKey=UMJWVRIJGCYYTH-UHFFFAOYSA-N
SMILES:C(C(CF)=C)(OCC)=O
Synonyms:- Acrylic acid, 2-(fluoromethyl)-, ethyl ester
- Ethyl 2-(fluoromethyl)acrylate
- Ethyl 2-(fluoromethyl)-2-propenoate
- 2-Propenoic acid, 2-(fluoromethyl)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.