CymitQuimica logo

CAS 75808-66-1

:

L-leucyl-L-valyl-L-valyl-L-tyrosyl-L-prolyl-L-tryptophyl-L-threonyl-L-glutaminyl-N~5~-(diaminomethylidene)-L-ornithyl-L-phenylalanine

Description:
The chemical substance known as L-leucyl-L-valyl-L-valyl-L-tyrosyl-L-prolyl-L-tryptophyl-L-threonyl-L-glutaminyl-N~5~-(diaminomethylidene)-L-ornithyl-L-phenylalanine, with the CAS number 75808-66-1, is a synthetic peptide that consists of a sequence of amino acids. This compound features a complex structure characterized by the presence of both standard amino acids and a modified amino acid, specifically N~5~-(diaminomethylidene)-L-ornithine. The peptide's sequence suggests potential biological activity, possibly related to protein synthesis or signaling pathways, due to the diverse functional groups present in its amino acid residues. The presence of aromatic and hydrophobic side chains, such as those from phenylalanine and tryptophan, may influence its solubility and interaction with biological membranes. Additionally, the peptide's structure may allow for specific conformational arrangements, which could be crucial for its biological function. Overall, this compound represents a unique example of peptide chemistry with potential applications in biochemistry and pharmacology.
Formula:C65H93N15O14
InChI:InChI=1/C65H93N15O14/c1-34(2)29-43(66)55(84)77-53(36(5)6)61(90)78-52(35(3)4)60(89)75-48(30-39-21-23-41(82)24-22-39)63(92)80-28-14-20-50(80)59(88)74-47(32-40-33-71-44-18-12-11-17-42(40)44)58(87)79-54(37(7)81)62(91)73-46(25-26-51(67)83)57(86)72-45(19-13-27-70-65(68)69)56(85)76-49(64(93)94)31-38-15-9-8-10-16-38/h8-12,15-18,21-24,33-37,43,45-50,52-54,71,81-82H,13-14,19-20,25-32,66H2,1-7H3,(H2,67,83)(H,72,86)(H,73,91)(H,74,88)(H,75,89)(H,76,85)(H,77,84)(H,78,90)(H,79,87)(H,93,94)(H4,68,69,70)/t37-,43+,45+,46+,47+,48+,49+,50+,52+,53+,54+/m1/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.