CymitQuimica logo

CAS 75808-94-5

:

2-(3-methylphenyl)-1,3-thiazolidine

Description:
2-(3-Methylphenyl)-1,3-thiazolidine is an organic compound characterized by its thiazolidine ring, which contains both sulfur and nitrogen atoms. The structure features a thiazolidine core substituted with a 3-methylphenyl group, contributing to its unique properties. This compound typically exhibits a moderate level of solubility in organic solvents due to its hydrophobic aromatic component, while its thiazolidine structure may impart some polar characteristics. It is often studied for its potential biological activities, including antimicrobial and anti-inflammatory properties, owing to the presence of the thiazolidine moiety, which is known for its reactivity and ability to participate in various chemical reactions. The compound's stability can be influenced by environmental factors such as temperature and pH. Additionally, its synthesis may involve methods such as cyclization reactions, making it of interest in synthetic organic chemistry. Overall, 2-(3-methylphenyl)-1,3-thiazolidine represents a class of compounds that can be explored for various applications in pharmaceuticals and materials science.
Formula:C10H13NS
InChI:InChI=1/C10H13NS/c1-8-3-2-4-9(7-8)10-11-5-6-12-10/h2-4,7,10-11H,5-6H2,1H3
SMILES:Cc1cccc(c1)C1NCCS1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.