CAS 7581-94-4
:rel-(1R,2R)-2-(1-Piperidinyl)cyclohexanol
Description:
Rel-(1R,2R)-2-(1-Piperidinyl)cyclohexanol, with the CAS number 7581-94-4, is a chiral organic compound characterized by its cyclohexanol structure, which features a piperidine ring attached to the cyclohexanol moiety. This compound exhibits specific stereochemistry, denoted by the (1R,2R) configuration, indicating the spatial arrangement of its atoms, which is crucial for its biological activity and interaction with other molecules. It is typically a solid at room temperature and is soluble in organic solvents, reflecting its hydrophobic characteristics due to the cyclohexane ring. The presence of the piperidine group contributes to its potential as a pharmacophore, making it of interest in medicinal chemistry for its possible applications in drug development. The compound may exhibit various functional properties, including potential analgesic or psychoactive effects, depending on its interaction with biological targets. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as temperature and pH.
Formula:C11H21NO
InChI:InChI=1/C11H21NO/c13-11-7-3-2-6-10(11)12-8-4-1-5-9-12/h10-11,13H,1-9H2/t10-,11-/s2
InChI key:InChIKey=UXCABTUQGBBPPF-DUJBIPCPNA-N
SMILES:O[C@H]1[C@H](N2CCCCC2)CCCC1
Synonyms:- (1R,2R)-2-(piperidin-1-yl)cyclohexanol
- Cyclohexanol, 2-(1-piperidinyl)-, (1R,2R)-rel-
- Cyclohexanol, 2-(1-piperidinyl)-, trans-
- Cyclohexanol, 2-piperidino-, trans-
- rel-(1R,2R)-2-(1-Piperidinyl)cyclohexanol
- trans-2-(1-Piperidinyl)cyclohexanol
- trans-2-Piperidinocyclohexanol
- trans-2-Piperidinocyclohexan-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.