CAS 75810-52-5
:2-(4-Chlorophenyl)-1-methyl-5-oxo-3-pyrrolidinecarboxylic acid
Description:
2-(4-Chlorophenyl)-1-methyl-5-oxo-3-pyrrolidinecarboxylic acid, with the CAS number 75810-52-5, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered cyclic amine. This compound features a carboxylic acid functional group, contributing to its acidic properties, and a ketone group, which enhances its reactivity. The presence of a 4-chlorophenyl group indicates that it has a chlorine substituent on the phenyl ring, which can influence its biological activity and lipophilicity. The methyl group attached to the nitrogen of the pyrrolidine ring adds to the steric bulk and may affect the compound's interaction with biological targets. This compound is of interest in medicinal chemistry and pharmacology, potentially serving as a scaffold for the development of therapeutic agents. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, its unique structure makes it a subject of study for various applications in chemical and pharmaceutical research.
Formula:C12H12ClNO3
InChI:InChI=1S/C12H12ClNO3/c1-14-10(15)6-9(12(16)17)11(14)7-2-4-8(13)5-3-7/h2-5,9,11H,6H2,1H3,(H,16,17)
InChI key:InChIKey=RUANRJGGZNVVBZ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C(N(C)C(=O)C1)C2=CC=C(Cl)C=C2
Synonyms:- 2-(4-Chlorophenyl)-1-methyl-5-oxo-3-pyrrolidinecarboxylic acid
- 3-Pyrrolidinecarboxylic acid, 2-(4-chlorophenyl)-1-methyl-5-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(4-CHLORO-PHENYL)-1-METHYL-5-OXO-PYRROLIDINE-3-CARBOXYLIC ACID
CAS:Formula:C12H12ClNO3Molecular weight:253.6816
