CAS 75822-11-6
:2,2,2-Trifluoro-1-(4-methoxy-3-methylphenyl)ethanone
Description:
2,2,2-Trifluoro-1-(4-methoxy-3-methylphenyl)ethanone, with CAS number 75822-11-6, is an organic compound characterized by its trifluoroacetyl group and a substituted aromatic ring. This compound features a trifluoromethyl group, which significantly enhances its lipophilicity and stability, making it useful in various chemical applications. The presence of the methoxy and methyl groups on the aromatic ring contributes to its electronic properties, potentially influencing its reactivity and interaction with biological systems. Typically, compounds like this may exhibit properties such as moderate volatility and solubility in organic solvents, while being less soluble in water due to their hydrophobic characteristics. The trifluoromethyl group often imparts unique biological activity, making such compounds of interest in pharmaceutical research. Additionally, the compound's structure suggests potential applications in agrochemicals or as intermediates in organic synthesis. Safety data should be consulted for handling and usage, as fluorinated compounds can exhibit specific toxicity profiles.
Formula:C10H9F3O2
InChI:InChI=1S/C10H9F3O2/c1-6-5-7(3-4-8(6)15-2)9(14)10(11,12)13/h3-5H,1-2H3
InChI key:InChIKey=KCQDIOQETYWJRX-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(=O)C1=CC(C)=C(OC)C=C1
Synonyms:- 2,2,2-Trifluoro-1-(4-methoxy-3-methylphenyl)ethan-1-one
- 2,2,2-Trifluoro-1-(4-methoxy-3-methylphenyl)ethanone
- Ethanone, 2,2,2-Trifluoro-1-(4-Methoxy-3-Methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.