CAS 75822-13-8
:4-(Dimethylamino)-α-(trifluoromethyl)benzenemethanol
Description:
4-(Dimethylamino)-α-(trifluoromethyl)benzenemethanol, with the CAS number 75822-13-8, is an organic compound characterized by its unique molecular structure, which includes a dimethylamino group and a trifluoromethyl group attached to a benzene ring. This compound typically exhibits properties such as being a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its ability to interact with biological systems. The presence of the trifluoromethyl group enhances its lipophilicity and metabolic stability, making it a valuable candidate in drug design. Additionally, the dimethylamino group can influence its basicity and solubility in different solvents. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, this compound's distinctive functional groups contribute to its chemical reactivity and potential utility in synthetic chemistry.
Formula:C10H12F3NO
InChI:InChI=1S/C10H12F3NO/c1-14(2)8-5-3-7(4-6-8)9(15)10(11,12)13/h3-6,9,15H,1-2H3
InChI key:InChIKey=SOYRNYDJSIZAFO-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(O)C1=CC=C(N(C)C)C=C1
Synonyms:- 4-(Dimethylamino)-α-(trifluoromethyl)benzenemethanol
- 2,2,2-Trifluoro-1-(4-dimethylaminophenyl)ethanol
- 1-(4-(Dimethylamino)phenyl)-2,2,2-trifluoroethanol
- Benzenemethanol, 4-(dimethylamino)-α-(trifluoromethyl)-
- 1-[4-(Dimethylamino)phenyl]-2,2,2-trifluoroethan-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
