
CAS 75837-81-9
:1,2,3,4-Tetrahydro-1-(4-methoxyphenyl)-2,4-dioxo-5-pyrimidinecarbonitrile
Description:
1,2,3,4-Tetrahydro-1-(4-methoxyphenyl)-2,4-dioxo-5-pyrimidinecarbonitrile is a chemical compound characterized by its complex structure, which includes a pyrimidine ring and various functional groups. This compound features a tetrahydro configuration, indicating the presence of a saturated cyclic structure, and it contains both dioxo and cyano groups, which contribute to its reactivity and potential biological activity. The methoxyphenyl substituent enhances its lipophilicity, potentially influencing its pharmacokinetic properties. The presence of the carbonitrile group may impart unique chemical reactivity, making it a candidate for various synthetic applications. This compound is of interest in medicinal chemistry, particularly for its potential therapeutic properties, which may include anti-inflammatory or anticancer activities. Its specific interactions and mechanisms of action would require further investigation through experimental studies. As with many organic compounds, safety data should be consulted before handling, as it may pose health risks depending on exposure levels.
Formula:C12H9N3O3
InChI:InChI=1S/C12H9N3O3/c1-18-10-4-2-9(3-5-10)15-7-8(6-13)11(16)14-12(15)17/h2-5,7H,1H3,(H,14,16,17)
InChI key:InChIKey=IUHGJPXHOBKFCM-UHFFFAOYSA-N
SMILES:O=C1N(C=C(C#N)C(=O)N1)C2=CC=C(OC)C=C2
Synonyms:- 5-Pyrimidinecarbonitrile, 1,2,3,4-tetrahydro-1-(4-methoxyphenyl)-2,4-dioxo-
- 1,2,3,4-Tetrahydro-1-(4-methoxyphenyl)-2,4-dioxo-5-pyrimidinecarbonitrile
- 1-(4-Methoxyphenyl)-2,4-dioxopyrimidine-5-carbonitrile
- 1-(4-Methoxyphenyl)-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(4-Methoxyphenyl)-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile
CAS:Formula:C12H9N3O3Color and Shape:SolidMolecular weight:243.2182
