CAS 7584-08-9

3,5-Dimethylisonicotinonitrile

Description:

3,5-Dimethylisonicotinonitrile, with the CAS number 7584-08-9, is a chemical compound that belongs to the class of nitriles and is a derivative of isonicotinonitrile. It features a pyridine ring substituted with two methyl groups at the 3 and 5 positions, along with a cyano group (-CN) at the 1 position. This compound is typically characterized by its solid state at room temperature and exhibits a relatively high melting point. It is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of the cyano group contributes to its reactivity, making it a useful intermediate in various chemical reactions. Additionally, 3,5-Dimethylisonicotinonitrile may exhibit specific solubility properties, often being soluble in polar organic solvents. Its structural features and functional groups allow for diverse chemical transformations, making it a valuable compound in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₈H₈N₂

InChI: InChI=1S/C8H8N2/c1-6-4-10-5-7(2)8(6)3-9/h4-5H,1-2H3

SMILES: Cc1cncc(C)c1C#N

3,5-Dimethylisonicotinonitrile

CAS: 7584-08-9

Formula: C₈H₈N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 132.1625

Ref: IN-DA00G47K

3,5-Dimethylisonicotinonitrile

CAS: 7584-08-9

3,5-Dimethylisonicotinonitrile

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 132.16g/mol

Ref: 54-OR60147

3,5-DIMETHYL-4-CYANOPYRIDINE

CAS: 7584-08-9

Formula: C₈H₈N₂

Purity: 97.0%

Color and Shape: Solid

Molecular weight: 132.166

Ref: 10-F306782