CymitQuimica logo

CAS 75843-50-4

:

2-(4-tert-butylphenoxy)acetohydrazide

Description:
2-(4-tert-butylphenoxy)acetohydrazide, with the CAS number 75843-50-4, is an organic compound characterized by its hydrazide functional group and a phenoxy moiety. This compound typically exhibits moderate solubility in organic solvents due to its hydrophobic tert-butyl group, which enhances its lipophilicity. The presence of the hydrazide functional group suggests potential reactivity, particularly in forming hydrazones or undergoing condensation reactions. It may also exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. The compound's structure allows for various intermolecular interactions, such as hydrogen bonding, which can influence its physical properties and reactivity. Additionally, the tert-butyl group can provide steric hindrance, affecting the compound's overall reactivity and interaction with other molecules. Overall, 2-(4-tert-butylphenoxy)acetohydrazide is a versatile compound with potential applications in various fields, including medicinal chemistry and materials science.
Formula:C12H18N2O2
InChI:InChI=1/C12H18N2O2/c1-12(2,3)9-4-6-10(7-5-9)16-8-11(15)14-13/h4-7H,8,13H2,1-3H3,(H,14,15)
SMILES:CC(C)(C)c1ccc(cc1)OCC(=NN)O
Synonyms:
  • (4-tert-Butyl-phenoxy)-acetic acid hydrazide
  • Acetic Acid, 2-[4-(1,1-Dimethylethyl)Phenoxy]-, Hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.