CAS 75849-06-8
:1-(2-methoxyphenyl)-3-(3-methoxyphenyl)propan-1-one
Description:
1-(2-Methoxyphenyl)-3-(3-methoxyphenyl)propan-1-one, also known by its CAS number 75849-06-8, is an organic compound characterized by its structure, which features two methoxy-substituted phenyl groups attached to a propanone backbone. This compound typically exhibits properties associated with ketones, including a carbonyl functional group that contributes to its reactivity and potential applications in organic synthesis. The presence of methoxy groups enhances its solubility in organic solvents and may influence its electronic properties, making it a candidate for various chemical reactions, including Friedel-Crafts acylation and other electrophilic aromatic substitutions. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical research. Its molecular structure suggests potential uses in the development of dyes, fragrances, or as intermediates in the synthesis of more complex organic molecules. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C17H18O3
InChI:InChI=1/C17H18O3/c1-19-14-7-5-6-13(12-14)10-11-16(18)15-8-3-4-9-17(15)20-2/h3-9,12H,10-11H2,1-2H3
SMILES:COc1cccc(CCC(=O)c2ccccc2OC)c1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.