CAS 75852-54-9

(5-fluorobiphenyl-3-yl)acetic acid

Description:

(5-Fluorobiphenyl-3-yl)acetic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond, with a fluorine atom substituted at the 5-position of one ring and an acetic acid functional group attached to the 3-position of the other ring. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylic acid group. The fluorine substitution can influence the compound's electronic properties, potentially enhancing its lipophilicity and affecting its biological activity. As a result, (5-fluorobiphenyl-3-yl)acetic acid may be of interest in pharmaceutical research and development, particularly in the design of new drugs or agrochemicals. Its molecular structure allows for various synthetic modifications, making it a versatile intermediate in organic synthesis. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₄H₁₁FO₂

InChI: InChI=1/C14H11FO2/c15-13-7-10(8-14(16)17)6-12(9-13)11-4-2-1-3-5-11/h1-7,9H,8H2,(H,16,17)

SMILES: c1ccc(cc1)c1cc(cc(c1)F)CC(=O)O

Synonyms:

• [1,1'-Biphenyl]-3-Acetic Acid, 5-Fluoro-
• (5-Fluorobiphenyl-3-yl)acetic acid

2-(5-Fluoro-[1,1'-biphenyl]-3-yl)acetic acid

CAS: 75852-54-9

Formula: C₁₄H₁₁FO₂

Molecular weight: 230.2343

Ref: IN-DA008P5W