CAS 75854-21-6

4-bromo-6-({[3-(trifluoromethyl)phenyl]amino}methylidene)cyclohexa-2,4-dien-1-one

Description:

4-bromo-6-({[3-(trifluoromethyl)phenyl]amino}methylidene)cyclohexa-2,4-dien-1-one, with the CAS number 75854-21-6, is a synthetic organic compound characterized by its complex structure, which includes a cyclohexadienone core. This compound features a bromine substituent and a trifluoromethyl group, which contribute to its unique chemical properties and reactivity. The presence of the amino group linked to a phenyl ring enhances its potential for various chemical interactions, making it of interest in medicinal chemistry and material science. The trifluoromethyl group is known for imparting lipophilicity and influencing the compound's biological activity. Additionally, the compound's conjugated system may exhibit interesting optical properties, such as UV-Vis absorption characteristics. Its stability and reactivity can be influenced by the electronic effects of the substituents, making it a candidate for further studies in organic synthesis and potential applications in pharmaceuticals or agrochemicals. Overall, this compound exemplifies the intricate interplay of functional groups in determining the behavior of organic molecules.

Formula: C₁₄H₉BrF₃NO

InChI: InChI=1/C14H9BrF3NO/c15-11-4-5-13(20)9(6-11)8-19-12-3-1-2-10(7-12)14(16,17)18/h1-8,19H

SMILES: c1cc(cc(c1)NC=C1C=C(C=CC1=O)Br)C(F)(F)F

4-bromo-2-({[3-(trifluoromethyl)phenyl]imino}methyl)phenol

CAS: 75854-21-6

4-bromo-2-({[3-(trifluoromethyl)phenyl]imino}methyl)phenol

Purity: ≥95%

Molecular weight: 344.13g/mol

Ref: 54-PC31155