
CAS 75854-66-9
:1-Bromo-3-methylhexane
Description:
1-Bromo-3-methylhexane is an organic compound classified as a haloalkane, specifically a bromoalkane, due to the presence of a bromine atom in its structure. Its molecular formula is C7H15Br, indicating it contains seven carbon atoms, fifteen hydrogen atoms, and one bromine atom. This compound features a hexane backbone with a methyl group attached to the third carbon, resulting in a branched structure. 1-Bromo-3-methylhexane is typically a colorless to pale yellow liquid at room temperature, exhibiting a characteristic odor. It is moderately soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The presence of the bromine atom makes it a good candidate for nucleophilic substitution reactions, often used in organic synthesis. Additionally, it can participate in elimination reactions under certain conditions. Safety precautions should be taken when handling this compound, as it may pose health risks, including skin and respiratory irritation. Proper storage in a cool, dry place away from light is recommended to maintain its stability.
Formula:C7H15Br
InChI:InChI=1S/C7H15Br/c1-3-4-7(2)5-6-8/h7H,3-6H2,1-2H3
InChI key:InChIKey=VTHCZPQORQUSGN-UHFFFAOYSA-N
SMILES:C(CCBr)(CCC)C
Synonyms:- 1-Bromo-3-methylhexane
- Hexane, 1-bromo-3-methyl-
- 3-Methylhexan-1-yl bromide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.