CAS 75861-31-3

2-amino-4,5-di(thiophen-2-yl)furan-3-carbonitrile

Description:

2-amino-4,5-di(thiophen-2-yl)furan-3-carbonitrile is an organic compound characterized by its unique structure, which includes a furan ring, amino group, and two thiophene substituents. This compound features a carbonitrile functional group, contributing to its potential reactivity and applications in various chemical processes. The presence of the thiophene rings enhances its electronic properties, making it of interest in organic electronics and materials science. The amino group can participate in hydrogen bonding and may influence the compound's solubility and reactivity. Additionally, the compound's structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Its specific properties, such as melting point, solubility, and spectral characteristics, would depend on the molecular interactions and the environment in which it is studied. Overall, 2-amino-4,5-di(thiophen-2-yl)furan-3-carbonitrile represents a versatile compound with potential utility in various fields of chemistry.

Formula: C₁₃H₈N₂OS₂

InChI: InChI=1/C13H8N2OS2/c14-7-8-11(9-3-1-5-17-9)12(16-13(8)15)10-4-2-6-18-10/h1-6H,15H2

SMILES: c1cc(c2c(C#N)c(N)oc2c2cccs2)sc1

Synonyms:

• 2-Amino-4,5-di-thiophen-2-yl-furan-3-carbonitrile

2-Amino-4,5-bis(thiophen-2-yl)furan-3-carbonitrile

CAS: 75861-31-3

Versatile small molecule scaffold

Formula: C₁₃H₈N₂OS₂

Purity: Min. 95%

Molecular weight: 272.3 g/mol

Ref: 3D-ADA86131