CAS 75865-45-1
:4-Bromo-2,3,5,6-tetrafluorobenzylalcohol
Description:
4-Bromo-2,3,5,6-tetrafluorobenzyl alcohol is an organic compound characterized by its complex halogenated aromatic structure. It features a benzyl alcohol moiety with a bromine atom and multiple fluorine substituents on the benzene ring, which significantly influence its chemical properties. The presence of these halogens typically enhances the compound's reactivity and polarity, making it useful in various chemical syntheses and applications. The bromine atom can serve as a site for nucleophilic substitution reactions, while the fluorine atoms can impart unique electronic properties, affecting the compound's solubility and stability. Additionally, the hydroxyl (-OH) group in the benzyl alcohol structure contributes to its potential as a hydrogen bond donor, which can influence its interactions in biological systems or with other chemical species. Overall, 4-Bromo-2,3,5,6-tetrafluorobenzyl alcohol is a versatile compound with applications in pharmaceuticals, agrochemicals, and materials science, owing to its distinctive halogenated characteristics.
Formula:C7H3BrF4O
InChI:InChI=1/C7H3BrF4O/c8-3-6(11)4(9)2(1-13)5(10)7(3)12/h13H,1H2
SMILES:C(c1c(c(c(c(c1F)F)Br)F)F)O
Synonyms:- (4-Bromo-2,3,5,6-Tetrafluorophenyl)Methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.