CymitQuimica logo

CAS 758665-04-2

:

3-(dimethylamino)butanoic acid

Description:
3-(Dimethylamino)butanoic acid, also known as DMBA, is an organic compound characterized by its structure, which includes a butanoic acid backbone with a dimethylamino group attached to the third carbon. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is soluble in water and polar organic solvents due to the presence of the carboxylic acid functional group, which can engage in hydrogen bonding. DMBA is known for its role in various biochemical applications, particularly in the synthesis of pharmaceuticals and as a potential precursor in the production of other organic compounds. Its dimethylamino group contributes to its basicity, making it a weak base. Additionally, DMBA may exhibit biological activity, which has led to interest in its effects on metabolism and potential applications in research. As with many chemical substances, safety precautions should be observed when handling DMBA, as it may pose health risks if ingested or improperly managed.
Formula:C6H13NO2
InChI:InChI=1/C6H13NO2/c1-5(7(2)3)4-6(8)9/h5H,4H2,1-3H3,(H,8,9)
SMILES:CC(CC(=O)O)N(C)C
Synonyms:
  • Butanoic Acid, 3-(Dimethylamino)-
  • 3-(DiMethylaMino)butanoic acid
  • Butanoic acid, 3-(dimethylamino)- (9CI)
  • 3-(dimethylamino)butanoic acid(SALTDATA: HCl)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.