CAS 75867-47-9

1-Nitro-2-[2-(trimethylsilyl)ethynyl]benzene

Description:

1-Nitro-2-[2-(trimethylsilyl)ethynyl]benzene, with the CAS number 75867-47-9, is an organic compound characterized by the presence of a nitro group and a trimethylsilyl-substituted ethynyl group attached to a benzene ring. This compound features a nitro group (-NO2) that typically imparts electrophilic characteristics, making it reactive in various chemical reactions. The trimethylsilyl group (Si(CH3)3) enhances the compound's stability and solubility in organic solvents, while also serving as a protecting group for functional groups during synthetic transformations. The ethynyl moiety contributes to the compound's potential for further functionalization, allowing for the formation of more complex structures. Additionally, the presence of the aromatic benzene ring provides resonance stabilization, influencing the compound's reactivity and interaction with other chemical species. Overall, 1-Nitro-2-[2-(trimethylsilyl)ethynyl]benzene is of interest in organic synthesis and materials science due to its unique structural features and reactivity.

Formula: C₁₁H₁₃NO₂Si

InChI: InChI=1S/C11H13NO2Si/c1-15(2,3)9-8-10-6-4-5-7-11(10)12(13)14/h4-7H,1-3H3

InChI key: InChIKey=UPZZKECKTANWRG-UHFFFAOYSA-N

SMILES: C(#C[Si](C)(C)C)C1=C(N(=O)=O)C=CC=C1

Synonyms:

• Silane, trimethyl[(2-nitrophenyl)ethynyl]-
• Benzene, 1-nitro-2-[2-(trimethylsilyl)ethynyl]-
• 1-Nitro-2-[2-(trimethylsilyl)ethynyl]benzene
• (2-Nitrophenylethynyl)trimethylsilane