CAS 758692-47-6
:Ethyl 2-(4-bromophenyl)-2-diazoacetate
Description:
Ethyl 2-(4-bromophenyl)-2-diazoacetate is a chemical compound characterized by its diazo functional group, which is known for its reactivity and utility in organic synthesis. This compound features an ethyl ester group, a bromophenyl moiety, and a diazoacetate structure, making it a versatile intermediate in various chemical reactions, particularly in the synthesis of azo compounds and in coupling reactions. The presence of the bromine atom enhances its electrophilic character, facilitating nucleophilic attack in subsequent reactions. Ethyl 2-(4-bromophenyl)-2-diazoacetate is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. It is important to handle this compound with care due to the potential hazards associated with diazo compounds, including their sensitivity to heat and light, which can lead to decomposition. Overall, this compound serves as a valuable building block in synthetic organic chemistry, particularly in the development of dyes, pharmaceuticals, and other functional materials.
Formula:C10H10BrN2O2
InChI:InChI=1/C10H9BrN2O2/c1-2-15-10(14)9(13-12)7-3-5-8(11)6-4-7/h3-6H,2H2,1H3
SMILES:CCOC(=O)C(=[N+]=[NH-])c1ccc(cc1)Br
Synonyms:- 4-Bromo-alpha-diazobenzeneacetic acid ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.