CymitQuimica logo

CAS 758697-67-5

:

B-[2-Fluoro-5-[(1-oxo-2-propen-1-yl)amino]phenyl]boronic acid

Description:
B-[2-Fluoro-5-[(1-oxo-2-propen-1-yl)amino]phenyl]boronic acid, with the CAS number 758697-67-5, is a boronic acid derivative characterized by the presence of a boron atom bonded to a phenyl group that is further substituted with a fluorine atom and an allylic amine. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and organic synthesis. The presence of the fluorine atom may enhance its biological activity or alter its physicochemical properties, such as solubility and reactivity. Additionally, the allylic amine functionality can participate in further chemical transformations, potentially leading to the synthesis of more complex molecules. Overall, this compound is of interest in research areas focused on drug development and materials science due to its unique structural features and reactivity.
Formula:C9H9BFNO3
InChI:InChI=1S/C9H9BFNO3/c1-2-9(13)12-6-3-4-8(11)7(5-6)10(14)15/h2-5,14-15H,1H2,(H,12,13)
InChI key:InChIKey=AHJCZDBIRPOOHT-UHFFFAOYSA-N
SMILES:N(C(C=C)=O)C1=CC(B(O)O)=C(F)C=C1
Synonyms:
  • [2-Fluoro-5-(prop-2-enamido)phenyl]boronic acid
  • (5-Acrylamido-2-fluorophenyl)boronic acid
  • Boronic acid, B-[2-fluoro-5-[(1-oxo-2-propen-1-yl)amino]phenyl]-
  • Boronic acid, [2-fluoro-5-[(1-oxo-2-propenyl)amino]phenyl]-
  • B-[2-Fluoro-5-[(1-oxo-2-propen-1-yl)amino]phenyl]boronic acid
  • 2-Fluoro-5-(1-oxo2-propenylamino)phenylboronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.