CymitQuimica logo

CAS 7587-15-7

:

2,5-Dichloro-4-iodophenol

Description:
2,5-Dichloro-4-iodophenol is an organic compound characterized by the presence of two chlorine atoms and one iodine atom attached to a phenolic ring. It is a derivative of phenol, which means it contains a hydroxyl (-OH) group that contributes to its chemical properties. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. Its molecular structure imparts specific reactivity, making it useful in organic synthesis and as an intermediate in the production of other chemical compounds. The presence of halogens (chlorine and iodine) enhances its biological activity and can influence its solubility and stability in different solvents. Additionally, 2,5-Dichloro-4-iodophenol may exhibit antimicrobial properties, making it of interest in research related to antimicrobial agents. Safety data should be consulted for handling and usage, as halogenated compounds can pose health risks. Overall, this compound is notable for its unique halogen substitutions and potential utility in chemical synthesis and biological applications.
Formula:C6H3Cl2IO
InChI:InChI=1S/C6H3Cl2IO/c7-3-2-6(10)4(8)1-5(3)9/h1-2,10H
InChI key:InChIKey=IAGXZGAELVSNRQ-UHFFFAOYSA-N
SMILES:ClC1=C(I)C=C(Cl)C(O)=C1
Synonyms:
  • 2,5-Dichloro-4-iodophenol
  • Phenol, 2,5-dichloro-4-iodo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.