CAS 75873-85-7
:N-cbz-leu-leu-glu B-naphthylamide
Description:
N-Cbz-leu-leu-glu B-naphthylamide, with the CAS number 75873-85-7, is a synthetic compound often used in biochemical research, particularly in the study of enzyme activity and peptide interactions. This compound features a Cbz (carbobenzyloxy) protecting group, which is commonly used to protect amino groups during peptide synthesis. The structure includes two leucine residues and one glutamic acid residue, contributing to its potential role in mimicking peptide substrates or inhibitors. The B-naphthylamide moiety enhances its hydrophobic character, which can influence its binding affinity and solubility in organic solvents. This compound is typically utilized in studies related to protease inhibition, as it can serve as a substrate or inhibitor for various enzymes. Its characteristics, such as stability under physiological conditions and specificity towards certain enzymes, make it a valuable tool in medicinal chemistry and drug design. As with many synthetic peptides, careful handling and storage are necessary to maintain its integrity and effectiveness in experimental applications.
Formula:C35H44N4O7
InChI:InChI=1/C35H44N4O7/c1-22(2)18-28(38-35(45)46-21-24-10-6-5-7-11-24)32(41)37-29(19-23(3)4)33(42)39(30(34(43)44)16-17-31(36)40)27-15-14-25-12-8-9-13-26(25)20-27/h5-15,20,22-23,28-30H,16-19,21H2,1-4H3,(H2,36,40)(H,37,41)(H,38,45)(H,43,44)/t28-,29-,30-/m0/s1
SMILES:CC(C)C[C@@H](C(=N[C@@H](CC(C)C)C(=O)N(c1ccc2ccccc2c1)[C@@H](CCC(=N)O)C(=O)O)O)N=C(O)OCc1ccccc1
Synonyms:- Z-Leu-Leu-Glu-.beta.NA
- N-[(benzyloxy)carbonyl]-L-leucyl-L-leucyl-N~2~-naphthalen-2-yl-L-glutamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Z-Leu-Leu-Glu-bNA
CAS:Z-Leu-Leu-Glu-bNA is a polypeptide that has been shown to activate the cytosolic fatty acid oxidation pathway in Xenopus oocytes. The polypeptide was found to inhibit the activity of enzymes involved in fatty acid synthesis and activation, such as acyl CoA synthetase, lipoyl CoA transferase, and acyl CoA oxidase. Z-Leu-Leu-Glu-bNA also inhibited protein synthesis in Caco2 cells by inhibiting the activity of protein kinase A (PKA) and phosphorylation of protein kinase B (PKB). These effects are mediated by lysine residues and proteolytic cleavage of Z-Leu-Leu-Glu-bNA.Formula:C35H44N4O7Purity:Min. 95%Molecular weight:632.75 g/mol

