CymitQuimica logo

CAS 75877-72-4

:

7,8-dimethoxy-3,4-dihydroisoquinoline

Description:
7,8-Dimethoxy-3,4-dihydroisoquinoline is a chemical compound characterized by its isoquinoline structure, which consists of a bicyclic system containing a benzene ring fused to a pyridine ring. This compound features two methoxy groups (-OCH3) attached to the 7 and 8 positions of the isoquinoline framework, contributing to its unique chemical properties and potential biological activities. The presence of the dihydro group indicates that the compound has undergone partial hydrogenation, which can influence its reactivity and stability. Typically, such compounds may exhibit various pharmacological activities, including neuroprotective and anti-inflammatory effects, making them of interest in medicinal chemistry. The CAS number 75877-72-4 serves as a unique identifier for this substance, facilitating its identification in chemical databases and literature. As with many organic compounds, its solubility, melting point, and reactivity can vary based on the specific conditions and solvents used. Overall, 7,8-dimethoxy-3,4-dihydroisoquinoline represents a significant structure in the realm of organic and medicinal chemistry.
Formula:C11H13NO2
InChI:InChI=1/C11H13NO2/c1-13-10-4-3-8-5-6-12-7-9(8)11(10)14-2/h3-4,7H,5-6H2,1-2H3
SMILES:COc1ccc2CCN=Cc2c1OC
Synonyms:
  • Isoquinoline, 3,4-Dihydro-7,8-Dimethoxy-
  • 7,8-Dimethoxy-3,4-dihydroisoquinoline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.