CAS 75885-59-5

2,2-Dimethyl Cyclopropyl Carboxylic Acid

Description:

2,2-Dimethylcyclopropyl carboxylic acid is a cyclic carboxylic acid characterized by its unique cyclopropane structure, which features two methyl groups attached to the cyclopropane ring. This compound has a carboxylic acid functional group (-COOH) that imparts acidic properties, making it capable of donating protons in solution. The presence of the two methyl groups contributes to its steric hindrance, influencing its reactivity and physical properties. Typically, such compounds exhibit moderate solubility in polar solvents due to the polar nature of the carboxylic acid group, while their cyclopropane ring can introduce strain, affecting stability and reactivity. The compound may participate in various chemical reactions, including esterification and decarboxylation, and can serve as a building block in organic synthesis. Its unique structure and properties make it of interest in fields such as medicinal chemistry and materials science. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₆H₁₀O₂

InChI: InChI=1/C6H10O2/c1-6(2)3-4(6)5(7)8/h4H,3H2,1-2H3,(H,7,8)

SMILES: CC1(C)CC1C(=O)O

Synonyms:

• 2,2-Dimethylcyclopropanecarboxylic acid
• Cyclopropanecarboxylic Acid, 2,2-Dimethyl-

2,2-Dimethylcyclopropanecarboxylic acid

CAS: 75885-59-5

Formula: C₆H₁₀O₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 114.1424

Ref: IN-DA0036KQ

2,2-Dimethylcyclopropylcarboxylic acid

CAS: 75885-59-5

2,2-Dimethylcyclopropylcarboxylic acid

Purity: 97%

Molecular weight: 114.14g/mol

Ref: 54-OR911879

2,2-Dimethylcyclopropylcarboxylic acid

Controlled Product

CAS: 75885-59-5

Stability Stench
Applications 2,2-Dimethylcyclopropylcarboxylic acid

Formula: C₆H₁₀O₂

Color and Shape: Neat

Molecular weight: 114.14

Ref: TR-D477853

2,2-Dimethylcyclopropanecarboxylic acid

CAS: 75885-59-5

Formula: C₆H₁₀O₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 114.144

Ref: 10-F066488