CAS 75887-99-9
:2-bromo-N-{2-[7-chloro-5-(2-fluorophenyl)-2-oxo-2,3-dihydro-1H-1,4-benzodiazepin-1-yl]ethyl}acetamide
Description:
2-bromo-N-{2-[7-chloro-5-(2-fluorophenyl)-2-oxo-2,3-dihydro-1H-1,4-benzodiazepin-1-yl]ethyl}acetamide is a complex organic compound characterized by its unique structural features, including a benzodiazepine core and various functional groups. The presence of a bromine atom and a chloro substituent contributes to its reactivity and potential biological activity. The compound also contains a fluorophenyl group, which may enhance its lipophilicity and influence its interaction with biological targets. The acetamide functional group suggests potential for hydrogen bonding, which can affect solubility and binding affinity in biological systems. This compound is of interest in medicinal chemistry, particularly for its potential pharmacological properties, including anxiolytic or sedative effects, typical of benzodiazepine derivatives. Its complex structure may also indicate potential for selective activity against specific receptors or enzymes. As with many synthetic compounds, understanding its stability, solubility, and reactivity is crucial for its application in research and development.
Formula:C19H16BrClFN3O2
InChI:InChI=1/C19H16BrClFN3O2/c20-10-17(26)23-7-8-25-16-6-5-12(21)9-14(16)19(24-11-18(25)27)13-3-1-2-4-15(13)22/h1-6,9H,7-8,10-11H2,(H,23,26)
SMILES:c1ccc(c(c1)C1=NCC(=O)N(CCN=C(CBr)O)c2ccc(cc12)Cl)F
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Bromo-N-[2-[7-Chloro-5-(2-Fluorophenyl)-2-Oxo-3H-1,4-Benzodiazepin-1-Yl]Ethyl]Acetamide
CAS:Controlled Product<p>2-Bromo-N-[2-[7-Chloro-5-(2-fluorophenyl)-2-oxo-3H-1,4-benzodiazepin-1-yl]ethyl]acetamide is a benzodiazepine derivative that binds to the benzodiazepine receptor and is also a calcium antagonist. It has been used in clinical studies as a chronic treatment for cancer and as an anticonvulsant. 2BBA acts on benzodiazepine receptors to inhibit the release of gamma aminobutyric acid (GABA) by binding to GABA A receptors. This prevents the binding of GABA with these receptors and leads to sedation and muscle relaxation. Flunitrazepam, which is chemically similar to 2BBA, is also used as a sedative and hypnotic drug. 2BBA has affinity constants that are between 50 nM and 100 μM for benzodiazepine binding sites, while its</p>Formula:C19H16BrClFN3O2Purity:Min. 95%Molecular weight:452.7 g/molKenazepine
CAS:<p>Kenazepine is a benzodiazepine cpd containing functional alkylating moiety.</p>Formula:C19H16BrClFN3O2Color and Shape:SolidMolecular weight:452.7

