CAS 75889-50-8
:6-Ethoxy-1,3-benzodioxole-5-carboxaldehyde
Description:
6-Ethoxy-1,3-benzodioxole-5-carboxaldehyde is an organic compound characterized by its unique structure, which includes a benzodioxole moiety and an aldehyde functional group. This compound typically appears as a pale yellow to light brown liquid or solid, depending on its purity and form. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water due to its hydrophobic characteristics. The presence of the ethoxy group enhances its reactivity, making it a potential candidate for various chemical reactions, including condensation and substitution reactions. Additionally, the aldehyde functional group can participate in further transformations, such as oxidation or reduction. This compound may be of interest in synthetic organic chemistry and could have applications in the development of pharmaceuticals or agrochemicals. However, as with many organic compounds, proper handling and safety precautions should be observed due to potential toxicity and reactivity.
Formula:C10H10O4
InChI:InChI=1S/C10H10O4/c1-2-12-8-4-10-9(13-6-14-10)3-7(8)5-11/h3-5H,2,6H2,1H3
InChI key:InChIKey=VQCXREJZJFLYAV-UHFFFAOYSA-N
SMILES:O(CC)C=1C=C2C(=CC1C=O)OCO2
Synonyms:- 1,3-Benzodioxole-5-carboxaldehyde, 6-ethoxy-
- 6-Ethoxy-1,3-benzodioxole-5-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.