CAS 759-51-3
:2-Pentenoic acid, 2-cyano-3-methyl-, ethyl ester
Description:
2-Pentenoic acid, 2-cyano-3-methyl-, ethyl ester, with the CAS number 759-51-3, is an organic compound characterized by its ester functional group and a cyano group attached to a pentenoic acid backbone. This compound typically appears as a colorless to pale yellow liquid and has a distinctive odor. It is soluble in organic solvents and exhibits moderate solubility in water due to the presence of both hydrophobic and hydrophilic regions in its molecular structure. The presence of the cyano group contributes to its reactivity, making it useful in various chemical synthesis applications, particularly in the production of pharmaceuticals and agrochemicals. Additionally, the unsaturated nature of the pentenoic acid portion allows for further chemical modifications, such as polymerization or addition reactions. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, this compound is of interest in organic chemistry for its versatile reactivity and potential applications in synthetic processes.
Formula:C9H13NO2
InChI:InChI=1S/C9H13NO2/c1-4-7(3)8(6-10)9(11)12-5-2/h4-5H2,1-3H3
InChI key:InChIKey=WBPLDHMXQALQAT-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)(=C(CC)C)C#N
Synonyms:- 2-Pentenoic acid, 2-cyano-3-methyl-, ethyl ester
- Ai3-04908
- Ethyl 2-Cyano-3-Methylpent-2-Enoate
- Ethyl 2-cyano-3-methyl-2-pentenoate
- NSC 67978
- ethyl (2E)-2-cyano-3-methylpent-2-enoate
- 2-Cyano-3-methylpent-2-enoic acid ethyl ester
- Ethyl 2-cyano-3-methylpent-2-ene-1-oate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
