CAS 759-54-6
:Ethyl 2-cyano-3-methyl-2-hexenoate
Description:
Ethyl 2-cyano-3-methyl-2-hexenoate, with the CAS number 759-54-6, is an organic compound characterized by its unique structure that includes a cyano group and an ester functional group. This compound typically appears as a colorless to pale yellow liquid and has a fruity odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic nature. Ethyl 2-cyano-3-methyl-2-hexenoate is known for its reactivity, particularly in Michael addition reactions and other nucleophilic additions, making it valuable in organic synthesis and the production of various chemical intermediates. Its molecular structure contributes to its properties, including boiling point and density, which are influenced by the presence of the cyano and ester groups. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested. Overall, it serves as an important building block in the synthesis of more complex organic molecules.
Formula:C10H15NO2
InChI:InChI=1/C10H15NO2/c1-4-6-8(3)9(7-11)10(12)13-5-2/h4-6H2,1-3H3/b9-8+
InChI key:InChIKey=WSQKZATUBMGUQX-UHFFFAOYSA-N
SMILES:C(=C(CCC)C)(C(OCC)=O)C#N
Synonyms:- 2-Cyano-3-methyl-hex-2-enoic acid ethyl ester
- 2-Hexenoic acid, 2-cyano-3-methyl-, ethyl ester
- Ethyl 2-cyano-3-methyl-2-hexenoate
- NSC 408230
- ethyl (2E)-2-cyano-3-methylhex-2-enoate
- Ethyl 2-cyano-3-methylhex-2-enoate
- 2-Cyano-3-methyl-2-hexenoic acid ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
