
CAS 75903-52-5
:Methyl 6-(aminosulfonyl)-2-pyridinecarboxylate
Description:
Methyl 6-(aminosulfonyl)-2-pyridinecarboxylate is a chemical compound characterized by its pyridine ring structure, which is substituted with both a carboxylate group and an aminosulfonyl group. This compound typically appears as a solid or crystalline substance and is soluble in polar solvents due to the presence of the carboxylate and sulfonamide functionalities. The aminosulfonyl group contributes to its potential as a bioactive molecule, possibly exhibiting pharmacological properties. The compound's molecular structure allows for various interactions, making it of interest in medicinal chemistry and drug development. Its CAS number, 75903-52-5, is a unique identifier that facilitates the tracking and study of this substance in scientific literature and databases. As with many organic compounds, its reactivity and stability can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial applications.
Formula:C7H8N2O4S
InChI:InChI=1S/C7H8N2O4S/c1-13-7(10)5-3-2-4-6(9-5)14(8,11)12/h2-4H,1H3,(H2,8,11,12)
InChI key:InChIKey=ZYZOLAJWAHUPOW-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1N=C(S(N)(=O)=O)C=CC1
Synonyms:- 2-Pyridinecarboxylic acid, 6-(aminosulfonyl)-, methyl ester
- Methyl 6-sulfamoylpyridine-2-carboxylate
- Methyl 6-(aminosulfonyl)-2-pyridinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.