CAS 75914-67-9
:N-Cyclobutylurea
Description:
N-Cyclobutylurea is an organic compound characterized by its urea functional group, where a cyclobutyl group is attached to the nitrogen atom. It typically appears as a white crystalline solid and is soluble in polar solvents such as water and alcohols. The molecular structure of N-Cyclobutylurea includes a four-membered cyclobutane ring, which contributes to its unique properties, including potential steric effects and reactivity. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a building block in organic synthesis. Its stability under standard conditions makes it suitable for various chemical reactions, although it may undergo hydrolysis or other transformations under specific conditions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, N-Cyclobutylurea represents a versatile compound with interesting chemical behavior and potential applications in research and industry.
Formula:C5H10N2O
InChI:InChI=1S/C5H10N2O/c6-5(8)7-4-2-1-3-4/h4H,1-3H2,(H3,6,7,8)
InChI key:InChIKey=XVDWZTJGQBNPFX-UHFFFAOYSA-N
SMILES:N(C(N)=O)C1CCC1
Synonyms:- NSC 117243
- N-Cyclobutylurea
- Urea, N-cyclobutyl-
- 1-Cyclobutylurea
- Urea, cyclobutyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.