CAS 75917-90-7
:(2E,4E,8Z,10E)-N-(2-methylpropyl)dodeca-2,4,8,10-tetraenamide
Description:
The chemical substance known as (2E,4E,8Z,10E)-N-(2-methylpropyl)dodeca-2,4,8,10-tetraenamide, with the CAS number 75917-90-7, is an organic compound characterized by its long carbon chain and multiple double bonds, specifically four conjugated double bonds in its dodeca structure. This compound features an amide functional group, which is indicative of its potential reactivity and interactions in biological systems. The presence of the 2-methylpropyl substituent suggests that it may exhibit hydrophobic properties, influencing its solubility and interaction with lipid membranes. The geometric descriptors (2E, 4E, 8Z, 10E) indicate the specific configurations of the double bonds, which can significantly affect the compound's physical and chemical properties, including its stability and reactivity. Such compounds are often studied for their potential applications in fields like biochemistry, materials science, and pharmaceuticals, where the unique structural features can lead to interesting biological activities or material characteristics.
Formula:C16H25NO
InChI:InChI=1/C16H25NO/c1-4-5-6-7-8-9-10-11-12-13-16(18)17-14-15(2)3/h4-7,10-13,15H,8-9,14H2,1-3H3,(H,17,18)/b5-4+,7-6-,11-10+,13-12+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Dodeca-2E,4E,8Z,10E-tetraenoic Acid Isobutylamide
CAS:Controlled ProductFormula:C16H25NOColor and Shape:NeatMolecular weight:326.393


