CAS 7592-99-6

1,4-bis(2-hydroxy-1-phenyl-ethyl)piperazine-2,5-dione

Description:

1,4-bis(2-hydroxy-1-phenyl-ethyl)piperazine-2,5-dione, also known by its CAS number 7592-99-6, is a chemical compound characterized by its piperazine core structure, which is substituted at the 1 and 4 positions with 2-hydroxy-1-phenyl-ethyl groups. This compound features a diketone functional group, specifically a piperazine-2,5-dione, which contributes to its reactivity and potential biological activity. The presence of hydroxyl groups enhances its solubility in polar solvents and may influence its interaction with biological systems. The phenyl groups attached to the ethyl chains suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its structural features may also impart specific properties such as antioxidant activity or the ability to act as a ligand in coordination chemistry. Overall, this compound's unique structure and functional groups make it of interest in various fields, including organic synthesis and drug development.

Formula: C₂₀H₂₂N₂O₄

InChI: InChI=1/C20H22N2O4/c23-13-17(15-7-3-1-4-8-15)21-11-20(26)22(12-19(21)25)18(14-24)16-9-5-2-6-10-16/h1-10,17-18,23-24H,11-14H2

SMILES: c1ccc(cc1)C(CO)N1CC(=O)N(CC1=O)C(CO)c1ccccc1