CAS 75920-10-4
:1,4,8,11-Tetraazatricyclo[9.3.1.1(4,8)]hexadecane
Description:
1,4,8,11-Tetraazatricyclo[9.3.1.1(4,8)]hexadecane, commonly referred to as TAT, is a polycyclic compound characterized by its unique tricyclic structure that incorporates four nitrogen atoms within its framework. This compound exhibits a high degree of symmetry and rigidity due to its fused ring system, which contributes to its stability and potential applications in various fields, including materials science and medicinal chemistry. TAT is known for its ability to form complexes with metal ions, making it of interest in coordination chemistry. Additionally, its nitrogen-rich structure may impart interesting electronic properties, potentially useful in the development of energetic materials or as a ligand in catalysis. The compound is typically synthesized through multi-step organic reactions, and its physical properties, such as solubility and melting point, can vary depending on the specific conditions of synthesis and purification. Overall, 1,4,8,11-Tetraazatricyclo[9.3.1.1(4,8)]hexadecane represents a fascinating subject of study due to its structural complexity and potential applications.
Formula:C12H24N4
InChI:InChI=1/C12H24N4/c1-3-13-7-9-15-5-2-6-16(12-15)10-8-14(4-1)11-13/h1-12H2
SMILES:C1CN2CCN3CCCN(CCN(C1)C2)C3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

