CAS 75926-54-4

2-(benzyloxy)-5-nitropyridine

Description:

2-(Benzyloxy)-5-nitropyridine is an organic compound characterized by its pyridine ring substituted with a benzyloxy group and a nitro group. The presence of the nitro group at the 5-position contributes to its electron-withdrawing properties, which can influence the compound's reactivity and polarity. The benzyloxy group, located at the 2-position, enhances the compound's lipophilicity and can affect its solubility in organic solvents. This compound typically appears as a solid at room temperature and may exhibit moderate stability under standard conditions. Its molecular structure allows for potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. The nitro group can serve as a site for further chemical modifications, making it a versatile intermediate in synthetic chemistry. Safety data should be consulted, as nitro compounds can be sensitive and may pose health risks if not handled properly. Overall, 2-(benzyloxy)-5-nitropyridine is a valuable compound in the field of organic chemistry with specific functional properties that can be exploited in various applications.

Formula: C₁₂H₁₀N₂O₃

InChI: InChI=1/C12H10N2O3/c15-14(16)11-6-7-12(13-8-11)17-9-10-4-2-1-3-5-10/h1-8H,9H2

SMILES: c1ccc(cc1)COc1ccc(cn1)N(=O)=O

2-(Benzyloxy)-5-nitropyridine

CAS: 75926-54-4

2-(Benzyloxy)-5-nitropyridine

Purity: 95%

Molecular weight: 230.22g/mol

Ref: 54-OR310560