CAS 75927-49-0
:Vinylboronic acid pinacol cyclic ester
Description:
Vinylboronic acid pinacol cyclic ester, with the CAS number 75927-49-0, is an organoboron compound characterized by the presence of both vinyl and boronic acid functional groups. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is known for its reactivity, particularly in cross-coupling reactions and as a building block in organic synthesis, especially in the formation of complex molecules. The boronic acid moiety allows for the formation of stable complexes with diols, making it useful in various applications, including medicinal chemistry and materials science. Additionally, the vinyl group provides opportunities for further functionalization through polymerization or other chemical transformations. Its solubility in organic solvents and moderate stability under standard laboratory conditions make it a versatile reagent in synthetic organic chemistry. However, like many organoboron compounds, it should be handled with care due to potential reactivity and toxicity.
Formula:C8H16BO3
InChI:InChI=1/C8H16BO3/c1-6-9(11)12-8(4,5)7(2,3)10/h6,10H,1H2,2-5H3/q-1
SMILES:C=CB([O-])OC(C)(C)C(C)(C)O
Synonyms:- Vinylboronicacidpinacolester
- Pinacol vinylboronate
- 4,4,5,5-Tetramethyl-2-Vinyl-1,3,2-Dioxaborolane
- Vinylboronic acid pinacol ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4,4,5,5-Tetramethyl-2-vinyl-1,3,2-dioxaborolane (stabilized with Phenothiazine)
CAS:Formula:C8H15BO2Purity:>93.0%(GC)Color and Shape:Colorless to Light orange to Yellow clear liquidMolecular weight:154.02Vinylboronic acid pinacol ester, 97%, stab.
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H15BO2Purity:97%Color and Shape:Clear colorless to pale yellow or pale pink, LiquidMolecular weight:154.022-Vinyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
CAS:Formula:C8H15BO2Purity:95%Color and Shape:LiquidMolecular weight:154.0145Vinylboronic acid, pinacol ester
CAS:Vinylboronic acid, pinacol esterFormula:C8H15BO2Purity:95%Color and Shape: clear. dark orange liquidMolecular weight:154.0145g/mol4,4,5,5-Tetramethyl-2-vinyl-1,3,2-dioxaborolane
CAS:Formula:C8H15BO2Purity:95.0%Color and Shape:Liquid, Clear LiquidMolecular weight:154.02Pinacol vinylboronate
CAS:Pinacol vinylboronate is an anticancer agent that has been shown to inhibit the growth of cancer cells. Pinacol vinylboronate inhibits the activity of cellular targets and generates reactive oxygen species through a hydrogen-bond-mediated mechanism, which eventually leads to cell death. This drug has also been shown to have functional groups that act as pharmacophores for cancer, which may be due to its ability to form hydrogen bonds with the hydroxyl group in DNA.Formula:C8H15BO2Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:154.01 g/mol





