CymitQuimica logo

CAS 75927-50-3

:

2-[3-(2-Methyl-1,3-dioxolan-2-yl)propyl]-1,3,2-dioxaborolane

Description:
2-[3-(2-Methyl-1,3-dioxolan-2-yl)propyl]-1,3,2-dioxaborolane, with the CAS number 75927-50-3, is a boron-containing organic compound characterized by its unique structural features, including a dioxaborolane ring and a dioxolane moiety. This compound typically exhibits properties associated with both boron and ether functionalities, which may influence its reactivity and solubility in various solvents. The presence of the dioxolane ring suggests potential applications in organic synthesis, particularly in the formation of boron-containing intermediates or as a reagent in cross-coupling reactions. Additionally, the compound may display interesting biological activities due to its structural complexity. Its stability and reactivity can be influenced by environmental factors such as temperature and pH. Overall, this compound represents a valuable class of boron compounds that can be utilized in synthetic organic chemistry and materials science. Further studies would be necessary to explore its full range of applications and properties in detail.
Formula:C9H17BO4
InChI:InChI=1S/C9H17BO4/c1-9(11-5-6-12-9)3-2-4-10-13-7-8-14-10/h2-8H2,1H3
InChI key:InChIKey=QZJOJDYBSFAPCX-UHFFFAOYSA-N
SMILES:C(CCB1OCCO1)C2(C)OCCO2
Synonyms:
  • 2-[3-(2-Methyl-1,3-dioxolan-2-yl)propyl]-1,3,2-dioxaborolane
  • 1,3,2-Dioxaborolane, 2-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.