CymitQuimica logo

CAS 75928-85-7

:

3-(Diethylamino)-4-methyl-2,6-pyridinedicarbonitrile

Description:
3-(Diethylamino)-4-methyl-2,6-pyridinedicarbonitrile, with the CAS number 75928-85-7, is a chemical compound characterized by its pyridine ring structure, which is substituted with a diethylamino group and two cyano groups. This compound typically exhibits properties associated with both basic and aromatic functionalities due to the presence of the pyridine moiety. The diethylamino group contributes to its basicity and potential solubility in polar solvents, while the cyano groups enhance its reactivity and may influence its electronic properties. The presence of the methyl group on the pyridine ring can affect steric hindrance and the overall stability of the molecule. This compound may be of interest in various fields, including organic synthesis and medicinal chemistry, due to its potential biological activity and utility as a building block in the development of pharmaceuticals or agrochemicals. As with many organic compounds, safety and handling precautions should be observed, given the potential toxicity associated with cyano-containing compounds.
Formula:C12H14N4
InChI:InChI=1S/C12H14N4/c1-4-16(5-2)12-9(3)6-10(7-13)15-11(12)8-14/h6H,4-5H2,1-3H3
InChI key:InChIKey=CMRIHPWWNMASTF-UHFFFAOYSA-N
SMILES:N(CC)(CC)C1=C(C#N)N=C(C#N)C=C1C
Synonyms:
  • 2,6-Pyridinedicarbonitrile, 3-(diethylamino)-4-methyl-
  • 3-(Diethylamino)-4-methyl-2,6-pyridinedicarbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.