CAS 75942-39-1

3,6-dioctyloxy-1,2-benzenedicarbonitrile

Description:

3,6-Dioctyloxy-1,2-benzenedicarbonitrile, with the CAS number 75942-39-1, is an organic compound characterized by its unique molecular structure, which includes a benzene ring substituted with two cyano groups and two octyloxy chains. The presence of the cyano groups (-C≡N) imparts notable polarity and potential reactivity, while the octyloxy groups enhance solubility in organic solvents and contribute to the compound's hydrophobic characteristics. This compound is typically used in materials science, particularly in the development of liquid crystals and organic semiconductors, due to its ability to form ordered structures. Its physical properties, such as melting point, boiling point, and solubility, can vary significantly based on the length of the alkyl chains and the overall molecular interactions. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as temperature and the presence of other chemicals. Overall, 3,6-dioctyloxy-1,2-benzenedicarbonitrile is a versatile compound with applications in advanced materials and electronic devices.

Formula: C₂₄H₃₆N₂O₂

InChI: InChI=1/C24H36N2O2/c1-3-5-7-9-11-13-17-27-23-15-16-24(22(20-26)21(23)19-25)28-18-14-12-10-8-6-4-2/h15-16H,3-14,17-18H2,1-2H3

SMILES: CCCCCCCCOc1ccc(c(C#N)c1C#N)OCCCCCCCC

Synonyms:

• 3,6-Bis(Octyloxy)Benzene-1,2-Dicarbonitrile

1,2-Benzenedicarbonitrile,3,6-bis(octyloxy)-

CAS: 75942-39-1

Formula: C₂₄H₃₆N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 384.5548

Ref: IN-DA005TBE

3,6-Dioctyloxyphthalonitrile

CAS: 75942-39-1

3,6-Dioctyloxyphthalonitrile

Purity: 98%

Molecular weight: 384.55g/mol

Ref: 54-OR91099

3,6-Dioctyloxy-1,2-benzenedicarbonitrile

CAS: 75942-39-1

Molecular weight: 384.55

Ref: 7W-GT7417

3,6-Dioctyloxyphthalonitrile

CAS: 75942-39-1

Purity: 98%

Molecular weight: 384.5639954

Ref: 10-F763175