CymitQuimica logo

CAS 759427-32-2

:

2,3-Dihydro-1-oxo-1H-indene-4-carboximidamide

Description:
2,3-Dihydro-1-oxo-1H-indene-4-carboximidamide, with the CAS number 759427-32-2, is a chemical compound characterized by its unique indene structure, which features a fused ring system. This compound typically exhibits properties associated with both amides and imides, contributing to its potential reactivity and biological activity. It may display moderate solubility in organic solvents, depending on the specific functional groups present. The presence of the carboximidamide functional group suggests potential for hydrogen bonding and interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's structure may influence its stability, reactivity, and interaction with other molecules. While specific physical properties such as melting point, boiling point, and spectral data are not provided, compounds of this type often undergo various chemical transformations, making them valuable in synthetic organic chemistry and pharmaceutical applications. Further studies would be necessary to fully elucidate its properties and potential uses in research or industry.
Formula:C10H10N2O
InChI:InChI=1S/C10H10N2O/c11-10(12)8-3-1-2-7-6(8)4-5-9(7)13/h1-3H,4-5H2,(H3,11,12)
InChI key:InChIKey=ATXHUWAEELZVAF-UHFFFAOYSA-N
SMILES:C(=N)(N)C1=C2C(C(=O)CC2)=CC=C1
Synonyms:
  • 1H-Indene-4-carboximidamide, 2,3-dihydro-1-oxo-
  • 2,3-Dihydro-1-oxo-1H-indene-4-carboximidamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.